C21H27NO4 — CID 121112218
2-(3,4-dimethoxyphenyl)-N-(5-hydroxy-3-phenylpentyl)acetamide (PubChem CID 121112218) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-(5-hydroxy-3-phenylpentyl)acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-(5-hydroxy-3-phenylpentyl)acetamide |
|---|---|
| PubChem CID | 121112218 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-(5-hydroxy-3-phenylpentyl)acetamide |
| SMILES | COc1ccc(CC(=O)NCCC(CCO)c2ccccc2)cc1OC |
| InChI | InChI=1S/C21H27NO4/c1-25-19-9-8-16(14-20(19)26-2)15-21(24)22-12-10-18(11-13-23)17-6-4-3-5-7-17/h3-9,14,18,23H,10-13,15H2,1-2H3,(H,22,24) |
| InChIKey | APMLVQNOAHMDLK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |