C15H17FN4O2 — CID 121121395
1-[(4-fluorophenyl)methyl]-3-[2-(5-methyl-6-oxopyrimidin-1-yl)ethyl]urea (PubChem CID 121121395) has the molecular formula C15H17FN4O2 and a molecular weight of 304.32 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-[2-(5-methyl-6-oxopyrimidin-1-yl)ethyl]urea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-[2-(5-methyl-6-oxopyrimidin-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 121121395 |
| Molecular Formula | C15H17FN4O2 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-[2-(5-methyl-6-oxopyrimidin-1-yl)ethyl]urea |
| SMILES | Cc1cncn(CCNC(=O)NCc2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C15H17FN4O2/c1-11-8-17-10-20(14(11)21)7-6-18-15(22)19-9-12-2-4-13(16)5-3-12/h2-5,8,10H,6-7,9H2,1H3,(H2,18,19,22) |
| InChIKey | DEHVZQDWIGXOAI-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |