C16H15NO3S4 — CID 121131782
5-ethyl-N-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]thiophene-2-sulfonamide (PubChem CID 121131782) has the molecular formula C16H15NO3S4 and a molecular weight of 397.57 g/mol. Its IUPAC name is 5-ethyl-N-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]thiophene-2-sulfonamide.
| Compound Name | 5-ethyl-N-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 121131782 |
| Molecular Formula | C16H15NO3S4 |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 396.99 |
| IUPAC Name | 5-ethyl-N-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]thiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NCc2ccc(C(=O)c3cccs3)s2)s1 |
| InChI | InChI=1S/C16H15NO3S4/c1-2-11-6-8-15(23-11)24(19,20)17-10-12-5-7-14(22-12)16(18)13-4-3-9-21-13/h3-9,17H,2,10H2,1H3 |
| InChIKey | OQWNTFAOBMWIOU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |