C14H13Cl2NO2S — CID 121132130
2,5-dichloro-N-(3-hydroxy-3-thiophen-3-ylpropyl)benzamide (PubChem CID 121132130) has the molecular formula C14H13Cl2NO2S and a molecular weight of 330.24 g/mol. Its IUPAC name is 2,5-dichloro-N-(3-hydroxy-3-thiophen-3-ylpropyl)benzamide.
| Compound Name | 2,5-dichloro-N-(3-hydroxy-3-thiophen-3-ylpropyl)benzamide |
|---|---|
| PubChem CID | 121132130 |
| Molecular Formula | C14H13Cl2NO2S |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | 2,5-dichloro-N-(3-hydroxy-3-thiophen-3-ylpropyl)benzamide |
| SMILES | O=C(NCCC(O)c1ccsc1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H13Cl2NO2S/c15-10-1-2-12(16)11(7-10)14(19)17-5-3-13(18)9-4-6-20-8-9/h1-2,4,6-8,13,18H,3,5H2,(H,17,19) |
| InChIKey | PZCZUJQGKNICHA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |