C13H17N3O3S — CID 121132078
N-(3-hydroxy-3-thiophen-3-ylpropyl)-3-methoxy-1-methylpyrazole-4-carboxamide (PubChem CID 121132078) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is N-(3-hydroxy-3-thiophen-3-ylpropyl)-3-methoxy-1-methylpyrazole-4-carboxamide.
| Compound Name | N-(3-hydroxy-3-thiophen-3-ylpropyl)-3-methoxy-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 121132078 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | N-(3-hydroxy-3-thiophen-3-ylpropyl)-3-methoxy-1-methylpyrazole-4-carboxamide |
| SMILES | COc1nn(C)cc1C(=O)NCCC(O)c1ccsc1 |
| InChI | InChI=1S/C13H17N3O3S/c1-16-7-10(13(15-16)19-2)12(18)14-5-3-11(17)9-4-6-20-8-9/h4,6-8,11,17H,3,5H2,1-2H3,(H,14,18) |
| InChIKey | ZUTIPAJHGOLBAK-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |