C15H14F3NO3S — CID 99981283
N-[(3R)-3-hydroxy-3-thiophen-3-ylpropyl]-4-(trifluoromethoxy)benzamide (PubChem CID 99981283) has the molecular formula C15H14F3NO3S and a molecular weight of 345.34 g/mol. Its IUPAC name is N-[(3R)-3-hydroxy-3-thiophen-3-ylpropyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[(3R)-3-hydroxy-3-thiophen-3-ylpropyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 99981283 |
| Molecular Formula | C15H14F3NO3S |
| Molecular Weight | 345.34 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | N-[(3R)-3-hydroxy-3-thiophen-3-ylpropyl]-4-(trifluoromethoxy)benzamide |
| SMILES | O=C(NCC[C@@H](O)c1ccsc1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H14F3NO3S/c16-15(17,18)22-12-3-1-10(2-4-12)14(21)19-7-5-13(20)11-6-8-23-9-11/h1-4,6,8-9,13,20H,5,7H2,(H,19,21)/t13-/m1/s1 |
| InChIKey | XNZOFWCSOGDYTL-CYBMUJFWSA-N |
| XLogP | 3.50 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |