C16H14BrNO4S2 — CID 121133577
2-bromo-N-[[5-[furan-2-yl(hydroxy)methyl]thiophen-2-yl]methyl]benzenesulfonamide (PubChem CID 121133577) has the molecular formula C16H14BrNO4S2 and a molecular weight of 428.33 g/mol. Its IUPAC name is 2-bromo-N-[[5-[furan-2-yl(hydroxy)methyl]thiophen-2-yl]methyl]benzenesulfonamide.
| Compound Name | 2-bromo-N-[[5-[furan-2-yl(hydroxy)methyl]thiophen-2-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121133577 |
| Molecular Formula | C16H14BrNO4S2 |
| Molecular Weight | 428.33 g/mol |
| Exact Mass | 426.95 |
| IUPAC Name | 2-bromo-N-[[5-[furan-2-yl(hydroxy)methyl]thiophen-2-yl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCc1ccc(C(O)c2ccco2)s1)c1ccccc1Br |
| InChI | InChI=1S/C16H14BrNO4S2/c17-12-4-1-2-6-15(12)24(20,21)18-10-11-7-8-14(23-11)16(19)13-5-3-9-22-13/h1-9,16,18-19H,10H2 |
| InChIKey | QUJFHHWNJMQSMQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.33 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |