About N-phenylhexanamide
N-phenylhexanamide (PubChem CID 12118) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is N-phenylhexanamide.
Molecular Properties
| Compound Name | N-phenylhexanamide |
| PubChem CID | 12118 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | N-phenylhexanamide |
| SMILES | CCCCCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C12H17NO/c1-2-3-5-10-12(14)13-11-8-6-4-7-9-11/h4,6-9H,2-3,5,10H2,1H3,(H,13,14) |
| InChIKey | JBTCHCWUNMZNEO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-phenylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenylhexanamide?
The IUPAC name of N-phenylhexanamide (CID 12118) is N-phenylhexanamide.
What is the SMILES notation for N-phenylhexanamide?
The canonical SMILES for N-phenylhexanamide is CCCCCC(=O)Nc1ccccc1.
What is the InChIKey of N-phenylhexanamide?
The InChIKey is JBTCHCWUNMZNEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-2-3-5-10-12(14)13-11-8-6-4-7-9-11/h4,6-9H,2-3,5,10H2,1H3,(H,13,14).
What are the key properties of N-phenylhexanamide?
N-phenylhexanamide has a molecular weight of 191.27 g/mol, XLogP of 3.21, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenylhexanamide is sourced from PubChem (CID 12118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).