C10H10Cl2N4 — CID 121200278
3-azido-1-[(3,5-dichlorophenyl)methyl]azetidine (PubChem CID 121200278) has the molecular formula C10H10Cl2N4 and a molecular weight of 257.12 g/mol. Its IUPAC name is 3-azido-1-[(3,5-dichlorophenyl)methyl]azetidine.
| Compound Name | 3-azido-1-[(3,5-dichlorophenyl)methyl]azetidine |
|---|---|
| PubChem CID | 121200278 |
| Molecular Formula | C10H10Cl2N4 |
| Molecular Weight | 257.12 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 3-azido-1-[(3,5-dichlorophenyl)methyl]azetidine |
| SMILES | [N-]=[N+]=NC1CN(Cc2cc(Cl)cc(Cl)c2)C1 |
| InChI | InChI=1S/C10H10Cl2N4/c11-8-1-7(2-9(12)3-8)4-16-5-10(6-16)14-15-13/h1-3,10H,4-6H2 |
| InChIKey | LNDQASDCQIZFBL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 52.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.12 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|