C20H15BrCl2N4O2 — CID 90713303
(6S,8S)-6-azido-8-[(4-bromophenyl)methyl]-2-(3,5-dichlorophenyl)-6,7-dihydro-5H-pyrrolizine-1,3-dione (PubChem CID 90713303) has the molecular formula C20H15BrCl2N4O2 and a molecular weight of 494.18 g/mol. Its IUPAC name is (6S,8S)-6-azido-8-[(4-bromophenyl)methyl]-2-(3,5-dichlorophenyl)-6,7-dihydro-5H-pyrrolizine-1,3-dione.
| Compound Name | (6S,8S)-6-azido-8-[(4-bromophenyl)methyl]-2-(3,5-dichlorophenyl)-6,7-dihydro-5H-pyrrolizine-1,3-dione |
|---|---|
| PubChem CID | 90713303 |
| Molecular Formula | C20H15BrCl2N4O2 |
| Molecular Weight | 494.18 g/mol |
| Exact Mass | 491.98 |
| IUPAC Name | (6S,8S)-6-azido-8-[(4-bromophenyl)methyl]-2-(3,5-dichlorophenyl)-6,7-dihydro-5H-pyrrolizine-1,3-dione |
| SMILES | [N-]=[N+]=N[C@@H]1CN2C(=O)C(c3cc(Cl)cc(Cl)c3)C(=O)[C@]2(Cc2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C20H15BrCl2N4O2/c21-13-3-1-11(2-4-13)8-20-9-16(25-26-24)10-27(20)19(29)17(18(20)28)12-5-14(22)7-15(23)6-12/h1-7,16-17H,8-10H2/t16-,17?,20-/m0/s1 |
| InChIKey | LPOXKGKAIYCDIY-CGOHPFHYSA-N |
| XLogP | 5.31 |
| TPSA | 86.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.18 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|