C12H9Cl2N5O2 — CID 141073384
6-azido-2-(3,5-dichlorophenyl)-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione (PubChem CID 141073384) has the molecular formula C12H9Cl2N5O2 and a molecular weight of 326.14 g/mol. Its IUPAC name is 6-azido-2-(3,5-dichlorophenyl)-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione.
| Compound Name | 6-azido-2-(3,5-dichlorophenyl)-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
|---|---|
| PubChem CID | 141073384 |
| Molecular Formula | C12H9Cl2N5O2 |
| Molecular Weight | 326.14 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | 6-azido-2-(3,5-dichlorophenyl)-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
| SMILES | [N-]=[N+]=NC1CC2C(=O)N(c3cc(Cl)cc(Cl)c3)C(=O)N2C1 |
| InChI | InChI=1S/C12H9Cl2N5O2/c13-6-1-7(14)3-9(2-6)19-11(20)10-4-8(16-17-15)5-18(10)12(19)21/h1-3,8,10H,4-5H2 |
| InChIKey | CMFAQGHUJWTSNI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 89.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.14 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|