C18H15Cl2N3O2W — CID 59917089
6-(3,5-dichlorophenyl)-3,7a-dihydro-1H-imidazo[1,5-c]imidazol-2-ide-5,7-dione;methanidylbenzene;tungsten(2+) (PubChem CID 59917089) has the molecular formula C18H15Cl2N3O2W and a molecular weight of 560.08 g/mol. Its IUPAC name is 6-(3,5-dichlorophenyl)-3,7a-dihydro-1H-imidazo[1,5-c]imidazol-2-ide-5,7-dione;methanidylbenzene;tungsten(2+).
| Compound Name | 6-(3,5-dichlorophenyl)-3,7a-dihydro-1H-imidazo[1,5-c]imidazol-2-ide-5,7-dione;methanidylbenzene;tungsten(2+) |
|---|---|
| PubChem CID | 59917089 |
| Molecular Formula | C18H15Cl2N3O2W |
| Molecular Weight | 560.08 g/mol |
| Exact Mass | 559.01 |
| IUPAC Name | 6-(3,5-dichlorophenyl)-3,7a-dihydro-1H-imidazo[1,5-c]imidazol-2-ide-5,7-dione;methanidylbenzene;tungsten(2+) |
| SMILES | O=C1C2C[N-]CN2C(=O)N1c1cc(Cl)cc(Cl)c1.[CH2-]c1ccccc1.[W+2] |
| InChI | InChI=1S/C11H8Cl2N3O2.C7H7.W/c12-6-1-7(13)3-8(2-6)16-10(17)9-4-14-5-15(9)11(16)18;1-7-5-3-2-4-6-7;/h1-3,9H,4-5H2;2-6H,1H2;/q2*-1;+2 |
| InChIKey | JXWMQNRFGFXUNO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 54.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.08 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|