C20H19BrCl2N2O2 — CID 59075288
(5S)-5-[(4-bromophenyl)methyl]-3-(3,5-dichlorophenyl)-5-methyl-1-propylimidazolidine-2,4-dione (PubChem CID 59075288) has the molecular formula C20H19BrCl2N2O2 and a molecular weight of 470.19 g/mol. Its IUPAC name is (5S)-5-[(4-bromophenyl)methyl]-3-(3,5-dichlorophenyl)-5-methyl-1-propylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-[(4-bromophenyl)methyl]-3-(3,5-dichlorophenyl)-5-methyl-1-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59075288 |
| Molecular Formula | C20H19BrCl2N2O2 |
| Molecular Weight | 470.19 g/mol |
| Exact Mass | 468.00 |
| IUPAC Name | (5S)-5-[(4-bromophenyl)methyl]-3-(3,5-dichlorophenyl)-5-methyl-1-propylimidazolidine-2,4-dione |
| SMILES | CCCN1C(=O)N(c2cc(Cl)cc(Cl)c2)C(=O)[C@]1(C)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C20H19BrCl2N2O2/c1-3-8-24-19(27)25(17-10-15(22)9-16(23)11-17)18(26)20(24,2)12-13-4-6-14(21)7-5-13/h4-7,9-11H,3,8,12H2,1-2H3/t20-/m0/s1 |
| InChIKey | IKCLYCRXMCTHPR-FQEVSTJZSA-N |
| XLogP | 5.94 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.19 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|