C27H29BrCl4N6O3 — CID 162324294
N-[4-[(5R)-5-[(4-bromophenyl)methyl]-3-(3,5-dichlorophenyl)-5-methyl-2,4-dioxoimidazolidin-1-yl]butyl]-6-hydrazinylpyridine-3-carboxamide;dihydrochloride (PubChem CID 162324294) has the molecular formula C27H29BrCl4N6O3 and a molecular weight of 707.28 g/mol. Its IUPAC name is N-[4-[(5R)-5-[(4-bromophenyl)methyl]-3-(3,5-dichlorophenyl)-5-methyl-2,4-dioxoimidazolidin-1-yl]butyl]-6-hydrazinylpyridine-3-carboxamide;dihydrochloride.
| Compound Name | N-[4-[(5R)-5-[(4-bromophenyl)methyl]-3-(3,5-dichlorophenyl)-5-methyl-2,4-dioxoimidazolidin-1-yl]butyl]-6-hydrazinylpyridine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 162324294 |
| Molecular Formula | C27H29BrCl4N6O3 |
| Molecular Weight | 707.28 g/mol |
| Exact Mass | 704.02 |
| IUPAC Name | N-[4-[(5R)-5-[(4-bromophenyl)methyl]-3-(3,5-dichlorophenyl)-5-methyl-2,4-dioxoimidazolidin-1-yl]butyl]-6-hydrazinylpyridine-3-carboxamide;dihydrochloride |
| SMILES | C[C@@]1(Cc2ccc(Br)cc2)C(=O)N(c2cc(Cl)cc(Cl)c2)C(=O)N1CCCCNC(=O)c1ccc(NN)nc1.Cl.Cl |
| InChI | InChI=1S/C27H27BrCl2N6O3.2ClH/c1-27(15-17-4-7-19(28)8-5-17)25(38)36(22-13-20(29)12-21(30)14-22)26(39)35(27)11-3-2-10-32-24(37)18-6-9-23(34-31)33-16-18;;/h4-9,12-14,16H,2-3,10-11,15,31H2,1H3,(H,32,37)(H,33,34);2*1H/t27-;;/m1../s1 |
| InChIKey | UVZSNMRHCYVECM-KFSCGDPASA-N |
| XLogP | 6.26 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.28 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|