C27H27N5O6 — CID 132961626
N-[6-[(4,5-dihydroxy-9,10-dioxoanthracene-2-carbonyl)amino]hexyl]-6-hydrazinylpyridine-3-carboxamide (PubChem CID 132961626) has the molecular formula C27H27N5O6 and a molecular weight of 517.54 g/mol. Its IUPAC name is N-[6-[(4,5-dihydroxy-9,10-dioxoanthracene-2-carbonyl)amino]hexyl]-6-hydrazinylpyridine-3-carboxamide.
| Compound Name | N-[6-[(4,5-dihydroxy-9,10-dioxoanthracene-2-carbonyl)amino]hexyl]-6-hydrazinylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 132961626 |
| Molecular Formula | C27H27N5O6 |
| Molecular Weight | 517.54 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | N-[6-[(4,5-dihydroxy-9,10-dioxoanthracene-2-carbonyl)amino]hexyl]-6-hydrazinylpyridine-3-carboxamide |
| SMILES | NNc1ccc(C(=O)NCCCCCCNC(=O)c2cc(O)c3c(c2)C(=O)c2cccc(O)c2C3=O)cn1 |
| InChI | InChI=1S/C27H27N5O6/c28-32-21-9-8-15(14-31-21)26(37)29-10-3-1-2-4-11-30-27(38)16-12-18-23(20(34)13-16)25(36)22-17(24(18)35)6-5-7-19(22)33/h5-9,12-14,33-34H,1-4,10-11,28H2,(H,29,37)(H,30,38)(H,31,32) |
| InChIKey | HGIUBYIFCZVROP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 183.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.54 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|