C21H20Br2Cl2N2O2 — CID 18682394
1-(4-bromobutyl)-5-[(4-bromophenyl)methyl]-3-(3,5-dichlorophenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 18682394) has the molecular formula C21H20Br2Cl2N2O2 and a molecular weight of 563.12 g/mol. Its IUPAC name is 1-(4-bromobutyl)-5-[(4-bromophenyl)methyl]-3-(3,5-dichlorophenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 1-(4-bromobutyl)-5-[(4-bromophenyl)methyl]-3-(3,5-dichlorophenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 18682394 |
| Molecular Formula | C21H20Br2Cl2N2O2 |
| Molecular Weight | 563.12 g/mol |
| Exact Mass | 559.93 |
| IUPAC Name | 1-(4-bromobutyl)-5-[(4-bromophenyl)methyl]-3-(3,5-dichlorophenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(Cc2ccc(Br)cc2)C(=O)N(c2cc(Cl)cc(Cl)c2)C(=O)N1CCCCBr |
| InChI | InChI=1S/C21H20Br2Cl2N2O2/c1-21(13-14-4-6-15(23)7-5-14)19(28)27(18-11-16(24)10-17(25)12-18)20(29)26(21)9-3-2-8-22/h4-7,10-12H,2-3,8-9,13H2,1H3 |
| InChIKey | NKHPHUICFIBVEI-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.12 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|