C24H27BCl2N2O4 — CID 59075265
(5R)-3-(3,5-dichlorophenyl)-1,5-dimethyl-5-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]imidazolidine-2,4-dione (PubChem CID 59075265) has the molecular formula C24H27BCl2N2O4 and a molecular weight of 489.21 g/mol. Its IUPAC name is (5R)-3-(3,5-dichlorophenyl)-1,5-dimethyl-5-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-3-(3,5-dichlorophenyl)-1,5-dimethyl-5-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59075265 |
| Molecular Formula | C24H27BCl2N2O4 |
| Molecular Weight | 489.21 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | (5R)-3-(3,5-dichlorophenyl)-1,5-dimethyl-5-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]imidazolidine-2,4-dione |
| SMILES | CN1C(=O)N(c2cc(Cl)cc(Cl)c2)C(=O)[C@@]1(C)Cc1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C24H27BCl2N2O4/c1-22(2)23(3,4)33-25(32-22)16-9-7-15(8-10-16)14-24(5)20(30)29(21(31)28(24)6)19-12-17(26)11-18(27)13-19/h7-13H,14H2,1-6H3/t24-/m1/s1 |
| InChIKey | PRDLJWZOQMGXJF-XMMPIXPASA-N |
| XLogP | 4.69 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.21 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|