C21H19BrCl2N2O4 — CID 18682541
4-[5-[(4-bromophenyl)methyl]-3-(3,5-dichlorophenyl)-5-methyl-2,4-dioxoimidazolidin-1-yl]butanoic acid (PubChem CID 18682541) has the molecular formula C21H19BrCl2N2O4 and a molecular weight of 514.20 g/mol. Its IUPAC name is 4-[5-[(4-bromophenyl)methyl]-3-(3,5-dichlorophenyl)-5-methyl-2,4-dioxoimidazolidin-1-yl]butanoic acid.
| Compound Name | 4-[5-[(4-bromophenyl)methyl]-3-(3,5-dichlorophenyl)-5-methyl-2,4-dioxoimidazolidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 18682541 |
| Molecular Formula | C21H19BrCl2N2O4 |
| Molecular Weight | 514.20 g/mol |
| Exact Mass | 511.99 |
| IUPAC Name | 4-[5-[(4-bromophenyl)methyl]-3-(3,5-dichlorophenyl)-5-methyl-2,4-dioxoimidazolidin-1-yl]butanoic acid |
| SMILES | CC1(Cc2ccc(Br)cc2)C(=O)N(c2cc(Cl)cc(Cl)c2)C(=O)N1CCCC(=O)O |
| InChI | InChI=1S/C21H19BrCl2N2O4/c1-21(12-13-4-6-14(22)7-5-13)19(29)26(17-10-15(23)9-16(24)11-17)20(30)25(21)8-2-3-18(27)28/h4-7,9-11H,2-3,8,12H2,1H3,(H,27,28) |
| InChIKey | AJOGNMHFQWUSNU-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.20 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|