C19H13Cl2F3N6O3 — CID 142655956
(6R,7aR)-6-azido-2-(2,6-dichloro-4-pyridinyl)-7a-[[4-(trifluoromethoxy)phenyl]methyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-1,3-dione (PubChem CID 142655956) has the molecular formula C19H13Cl2F3N6O3 and a molecular weight of 501.25 g/mol. Its IUPAC name is (6R,7aR)-6-azido-2-(2,6-dichloro-4-pyridinyl)-7a-[[4-(trifluoromethoxy)phenyl]methyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-1,3-dione.
| Compound Name | (6R,7aR)-6-azido-2-(2,6-dichloro-4-pyridinyl)-7a-[[4-(trifluoromethoxy)phenyl]methyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-1,3-dione |
|---|---|
| PubChem CID | 142655956 |
| Molecular Formula | C19H13Cl2F3N6O3 |
| Molecular Weight | 501.25 g/mol |
| Exact Mass | 500.04 |
| IUPAC Name | (6R,7aR)-6-azido-2-(2,6-dichloro-4-pyridinyl)-7a-[[4-(trifluoromethoxy)phenyl]methyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-1,3-dione |
| SMILES | [N-]=[N+]=N[C@H]1CN2C(=O)N(c3cc(Cl)nc(Cl)c3)C(=O)[C@@]2(Cc2ccc(OC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C19H13Cl2F3N6O3/c20-14-5-12(6-15(21)26-14)30-16(31)18(8-11(27-28-25)9-29(18)17(30)32)7-10-1-3-13(4-2-10)33-19(22,23)24/h1-6,11H,7-9H2/t11-,18-/m1/s1 |
| InChIKey | HCMXWUBZPZWVHP-ADLMAVQZSA-N |
| XLogP | 5.12 |
| TPSA | 111.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.25 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|