C9H12N2O — CID 121204170
(1-amino-2,3-dihydroindol-4-yl)methanol (PubChem CID 121204170) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is (1-amino-2,3-dihydroindol-4-yl)methanol.
| Compound Name | (1-amino-2,3-dihydroindol-4-yl)methanol |
|---|---|
| PubChem CID | 121204170 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | (1-amino-2,3-dihydroindol-4-yl)methanol |
| SMILES | NN1CCc2c(CO)cccc21 |
| InChI | InChI=1S/C9H12N2O/c10-11-5-4-8-7(6-12)2-1-3-9(8)11/h1-3,12H,4-6,10H2 |
| InChIKey | JECRXOHSJDFEKS-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|