C11H16BNO2 — CID 149245205
[8-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-methylborinic acid (PubChem CID 149245205) has the molecular formula C11H16BNO2 and a molecular weight of 205.07 g/mol. Its IUPAC name is [8-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-methylborinic acid.
| Compound Name | [8-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-methylborinic acid |
|---|---|
| PubChem CID | 149245205 |
| Molecular Formula | C11H16BNO2 |
| Molecular Weight | 205.07 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | [8-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-methylborinic acid |
| SMILES | CB(O)N1CCc2cccc(CO)c2C1 |
| InChI | InChI=1S/C11H16BNO2/c1-12(15)13-6-5-9-3-2-4-10(8-14)11(9)7-13/h2-4,14-15H,5-8H2,1H3 |
| InChIKey | XMYWKRUFOMNZAC-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.07 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|