C11H13BN2O — CID 18683089
(8-isocyano-3,4-dihydro-1H-isoquinolin-2-yl)-methylborinic acid (PubChem CID 18683089) has the molecular formula C11H13BN2O and a molecular weight of 200.05 g/mol. Its IUPAC name is (8-isocyano-3,4-dihydro-1H-isoquinolin-2-yl)-methylborinic acid.
| Compound Name | (8-isocyano-3,4-dihydro-1H-isoquinolin-2-yl)-methylborinic acid |
|---|---|
| PubChem CID | 18683089 |
| Molecular Formula | C11H13BN2O |
| Molecular Weight | 200.05 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | (8-isocyano-3,4-dihydro-1H-isoquinolin-2-yl)-methylborinic acid |
| SMILES | [C-]#[N+]c1cccc2c1CN(B(C)O)CC2 |
| InChI | InChI=1S/C11H13BN2O/c1-12(15)14-7-6-9-4-3-5-11(13-2)10(9)8-14/h3-5,15H,6-8H2,1H3 |
| InChIKey | FCMWSZBIDLXBHU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 27.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.05 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|