C15H22BN3O2 — CID 156680020
methyl-[7-(3-methyl-2-oxo-1,3-diazinan-1-yl)-3,4-dihydro-1H-isoquinolin-2-yl]borinic acid (PubChem CID 156680020) has the molecular formula C15H22BN3O2 and a molecular weight of 287.17 g/mol. Its IUPAC name is methyl-[7-(3-methyl-2-oxo-1,3-diazinan-1-yl)-3,4-dihydro-1H-isoquinolin-2-yl]borinic acid.
| Compound Name | methyl-[7-(3-methyl-2-oxo-1,3-diazinan-1-yl)-3,4-dihydro-1H-isoquinolin-2-yl]borinic acid |
|---|---|
| PubChem CID | 156680020 |
| Molecular Formula | C15H22BN3O2 |
| Molecular Weight | 287.17 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | methyl-[7-(3-methyl-2-oxo-1,3-diazinan-1-yl)-3,4-dihydro-1H-isoquinolin-2-yl]borinic acid |
| SMILES | CB(O)N1CCc2ccc(N3CCCN(C)C3=O)cc2C1 |
| InChI | InChI=1S/C15H22BN3O2/c1-16(21)18-9-6-12-4-5-14(10-13(12)11-18)19-8-3-7-17(2)15(19)20/h4-5,10,21H,3,6-9,11H2,1-2H3 |
| InChIKey | XAHLQUXYVMURBQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.17 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|