C13H19N3O — CID 121204496
2-(2,3,5,5a,6,7,8,8a-octahydrocyclopenta[e][1,4]oxazepin-1-yl)pyridin-3-amine (PubChem CID 121204496) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-(2,3,5,5a,6,7,8,8a-octahydrocyclopenta[e][1,4]oxazepin-1-yl)pyridin-3-amine.
| Compound Name | 2-(2,3,5,5a,6,7,8,8a-octahydrocyclopenta[e][1,4]oxazepin-1-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 121204496 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 2-(2,3,5,5a,6,7,8,8a-octahydrocyclopenta[e][1,4]oxazepin-1-yl)pyridin-3-amine |
| SMILES | Nc1cccnc1N1CCOCC2CCCC21 |
| InChI | InChI=1S/C13H19N3O/c14-11-4-2-6-15-13(11)16-7-8-17-9-10-3-1-5-12(10)16/h2,4,6,10,12H,1,3,5,7-9,14H2 |
| InChIKey | YJHJTRNWZGRTPH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |