C10H13N3O2 — CID 121206665
2-(6-tert-butyl-2,4-dioxopyrimidin-1-yl)acetonitrile (PubChem CID 121206665) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 2-(6-tert-butyl-2,4-dioxopyrimidin-1-yl)acetonitrile.
| Compound Name | 2-(6-tert-butyl-2,4-dioxopyrimidin-1-yl)acetonitrile |
|---|---|
| PubChem CID | 121206665 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 2-(6-tert-butyl-2,4-dioxopyrimidin-1-yl)acetonitrile |
| SMILES | CC(C)(C)c1cc(=O)[nH]c(=O)n1CC#N |
| InChI | InChI=1S/C10H13N3O2/c1-10(2,3)7-6-8(14)12-9(15)13(7)5-4-11/h6H,5H2,1-3H3,(H,12,14,15) |
| InChIKey | MZFNHFLSAPRJOP-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |