C9H11Cl3N2O3 — CID 71202000
1-(2-ethoxyethyl)-6-(trichloromethyl)pyrimidine-2,4-dione (PubChem CID 71202000) has the molecular formula C9H11Cl3N2O3 and a molecular weight of 301.56 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-6-(trichloromethyl)pyrimidine-2,4-dione.
| Compound Name | 1-(2-ethoxyethyl)-6-(trichloromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 71202000 |
| Molecular Formula | C9H11Cl3N2O3 |
| Molecular Weight | 301.56 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | 1-(2-ethoxyethyl)-6-(trichloromethyl)pyrimidine-2,4-dione |
| SMILES | CCOCCn1c(C(Cl)(Cl)Cl)cc(=O)[nH]c1=O |
| InChI | InChI=1S/C9H11Cl3N2O3/c1-2-17-4-3-14-6(9(10,11)12)5-7(15)13-8(14)16/h5H,2-4H2,1H3,(H,13,15,16) |
| InChIKey | VQTZUYKSLCOMJY-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.56 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|