C9H12ClN3 — CID 121215190
7-(chloromethyl)-1-ethyl-6-methylimidazo[2,1-e]pyrazole (PubChem CID 121215190) has the molecular formula C9H12ClN3 and a molecular weight of 197.67 g/mol. Its IUPAC name is 7-(chloromethyl)-1-ethyl-6-methylimidazo[2,1-e]pyrazole.
| Compound Name | 7-(chloromethyl)-1-ethyl-6-methylimidazo[2,1-e]pyrazole |
|---|---|
| PubChem CID | 121215190 |
| Molecular Formula | C9H12ClN3 |
| Molecular Weight | 197.67 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 7-(chloromethyl)-1-ethyl-6-methylimidazo[2,1-e]pyrazole |
| SMILES | CCn1ccn2nc(C)c(CCl)c12 |
| InChI | InChI=1S/C9H12ClN3/c1-3-12-4-5-13-9(12)8(6-10)7(2)11-13/h4-5H,3,6H2,1-2H3 |
| InChIKey | WNLWATUUVRTPAL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 22.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.67 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|