C12H16ClN3 — CID 121215281
7-(chloromethyl)-6-cyclobutyl-1-ethylimidazo[1,2-b]pyrazole (PubChem CID 121215281) has the molecular formula C12H16ClN3 and a molecular weight of 237.73 g/mol. Its IUPAC name is 7-(chloromethyl)-6-cyclobutyl-1-ethylimidazo[1,2-b]pyrazole.
| Compound Name | 7-(chloromethyl)-6-cyclobutyl-1-ethylimidazo[1,2-b]pyrazole |
|---|---|
| PubChem CID | 121215281 |
| Molecular Formula | C12H16ClN3 |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 7-(chloromethyl)-6-cyclobutyl-1-ethylimidazo[1,2-b]pyrazole |
| SMILES | CCn1ccn2nc(C3CCC3)c(CCl)c12 |
| InChI | InChI=1S/C12H16ClN3/c1-2-15-6-7-16-12(15)10(8-13)11(14-16)9-4-3-5-9/h6-7,9H,2-5,8H2,1H3 |
| InChIKey | XGTHCMTYOHYAQM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 22.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|