C10H7N5S — CID 121215591
3-phenyl-6H-[1,2,4]triazolo[4,3-d][1,2,4]triazine-5-thione (PubChem CID 121215591) has the molecular formula C10H7N5S and a molecular weight of 229.27 g/mol. Its IUPAC name is 3-phenyl-6H-[1,2,4]triazolo[4,3-d][1,2,4]triazine-5-thione.
| Compound Name | 3-phenyl-6H-[1,2,4]triazolo[4,3-d][1,2,4]triazine-5-thione |
|---|---|
| PubChem CID | 121215591 |
| Molecular Formula | C10H7N5S |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 3-phenyl-6H-[1,2,4]triazolo[4,3-d][1,2,4]triazine-5-thione |
| SMILES | S=c1[nH]ncc2nnc(-c3ccccc3)n12 |
| InChI | InChI=1S/C10H7N5S/c16-10-14-11-6-8-12-13-9(15(8)10)7-4-2-1-3-5-7/h1-6H,(H,14,16) |
| InChIKey | OFBJJMBCSDYBOX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|