C11H18O2 — CID 121216706
(2E,6E)-5-propan-2-yloxyocta-2,6-dienal (PubChem CID 121216706) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (2E,6E)-5-propan-2-yloxyocta-2,6-dienal.
| Compound Name | (2E,6E)-5-propan-2-yloxyocta-2,6-dienal |
|---|---|
| PubChem CID | 121216706 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (2E,6E)-5-propan-2-yloxyocta-2,6-dienal |
| SMILES | C/C=C/C(C/C=C/C=O)OC(C)C |
| InChI | InChI=1S/C11H18O2/c1-4-7-11(13-10(2)3)8-5-6-9-12/h4-7,9-11H,8H2,1-3H3/b6-5+,7-4+ |
| InChIKey | BOMWSSDHUAIJIW-HVUXDCMCSA-N |
| XLogP | 2.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|