C11H18INO3 — CID 121223083
tert-butyl 2-[2-(2-iodoethyl)-4-oxoazetidin-1-yl]acetate (PubChem CID 121223083) has the molecular formula C11H18INO3 and a molecular weight of 339.17 g/mol. Its IUPAC name is tert-butyl 2-[2-(2-iodoethyl)-4-oxoazetidin-1-yl]acetate.
| Compound Name | tert-butyl 2-[2-(2-iodoethyl)-4-oxoazetidin-1-yl]acetate |
|---|---|
| PubChem CID | 121223083 |
| Molecular Formula | C11H18INO3 |
| Molecular Weight | 339.17 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | tert-butyl 2-[2-(2-iodoethyl)-4-oxoazetidin-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1C(=O)CC1CCI |
| InChI | InChI=1S/C11H18INO3/c1-11(2,3)16-10(15)7-13-8(4-5-12)6-9(13)14/h8H,4-7H2,1-3H3 |
| InChIKey | QISWFFJDTJTOSA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.17 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|