C33H56N4O10 — CID 170690388
(2,5-dioxocyclopentyl) 2-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate (PubChem CID 170690388) has the molecular formula C33H56N4O10 and a molecular weight of 668.83 g/mol. Its IUPAC name is (2,5-dioxocyclopentyl) 2-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate.
| Compound Name | (2,5-dioxocyclopentyl) 2-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate |
|---|---|
| PubChem CID | 170690388 |
| Molecular Formula | C33H56N4O10 |
| Molecular Weight | 668.83 g/mol |
| Exact Mass | 668.40 |
| IUPAC Name | (2,5-dioxocyclopentyl) 2-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1CCN(CC(=O)OC2C(=O)CCC2=O)CCN(CC(=O)OC(C)(C)C)CCN(CC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C33H56N4O10/c1-31(2,3)45-27(41)21-35-14-12-34(20-26(40)44-30-24(38)10-11-25(30)39)13-15-36(22-28(42)46-32(4,5)6)17-19-37(18-16-35)23-29(43)47-33(7,8)9/h30H,10-23H2,1-9H3 |
| InChIKey | GUAWBYKMTLIOMB-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 152.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.83 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|