C13H22N2O3 — CID 140981417
tert-butyl 2-(3-amino-6-ethyl-2-hydroxy-2H-pyridin-1-yl)acetate (PubChem CID 140981417) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is tert-butyl 2-(3-amino-6-ethyl-2-hydroxy-2H-pyridin-1-yl)acetate.
| Compound Name | tert-butyl 2-(3-amino-6-ethyl-2-hydroxy-2H-pyridin-1-yl)acetate |
|---|---|
| PubChem CID | 140981417 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | tert-butyl 2-(3-amino-6-ethyl-2-hydroxy-2H-pyridin-1-yl)acetate |
| SMILES | CCC1=CC=C(N)C(O)N1CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H22N2O3/c1-5-9-6-7-10(14)12(17)15(9)8-11(16)18-13(2,3)4/h6-7,12,17H,5,8,14H2,1-4H3 |
| InChIKey | IIWOLGPWKXJKDD-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |