C11H18O2 — CID 121223982
2-[(2E)-3-methylpenta-2,4-dienoxy]oxane (PubChem CID 121223982) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 2-[(2E)-3-methylpenta-2,4-dienoxy]oxane.
| Compound Name | 2-[(2E)-3-methylpenta-2,4-dienoxy]oxane |
|---|---|
| PubChem CID | 121223982 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 2-[(2E)-3-methylpenta-2,4-dienoxy]oxane |
| SMILES | C=C/C(C)=C/COC1CCCCO1 |
| InChI | InChI=1S/C11H18O2/c1-3-10(2)7-9-13-11-6-4-5-8-12-11/h3,7,11H,1,4-6,8-9H2,2H3/b10-7+ |
| InChIKey | XZEIXMSKRUMBNQ-JXMROGBWSA-N |
| XLogP | 2.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|