About methyl 3-oxo-5,6,7,8-tetrahydro-1H-isochromene-8a-carboxylate
methyl 3-oxo-5,6,7,8-tetrahydro-1H-isochromene-8a-carboxylate (PubChem CID 121224031) has the molecular formula C11H14O4
and a molecular weight of 210.23 g/mol. Its IUPAC name is methyl 3-oxo-5,6,7,8-tetrahydro-1H-isochromene-8a-carboxylate.
Analyze methyl 3-oxo-5,6,7,8-tetrahydro-1H-isochromene-8a-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-oxo-5,6,7,8-tetrahydro-1H-isochromene-8a-carboxylate?
The IUPAC name of methyl 3-oxo-5,6,7,8-tetrahydro-1H-isochromene-8a-carboxylate (CID 121224031) is methyl 3-oxo-5,6,7,8-tetrahydro-1H-isochromene-8a-carboxylate.
What is the SMILES notation for methyl 3-oxo-5,6,7,8-tetrahydro-1H-isochromene-8a-carboxylate?
The canonical SMILES for methyl 3-oxo-5,6,7,8-tetrahydro-1H-isochromene-8a-carboxylate is COC(=O)C12CCCCC1=CC(=O)OC2.
What is the InChIKey of methyl 3-oxo-5,6,7,8-tetrahydro-1H-isochromene-8a-carboxylate?
The InChIKey is AMAWHXFQAGGMPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O4/c1-14-10(13)11-5-3-2-4-8(11)6-9(12)15-7-11/h6H,2-5,7H2,1H3.
What are the key properties of methyl 3-oxo-5,6,7,8-tetrahydro-1H-isochromene-8a-carboxylate?
methyl 3-oxo-5,6,7,8-tetrahydro-1H-isochromene-8a-carboxylate has a molecular weight of 210.23 g/mol, XLogP of 1.20, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-oxo-5,6,7,8-tetrahydro-1H-isochromene-8a-carboxylate is sourced from PubChem (CID 121224031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).