C11H10F3N7 — CID 121224764
5-[[3-(trifluoromethyl)phenyl]diazenyl]pyrimidine-2,4,6-triamine (PubChem CID 121224764) has the molecular formula C11H10F3N7 and a molecular weight of 297.24 g/mol. Its IUPAC name is 5-[[3-(trifluoromethyl)phenyl]diazenyl]pyrimidine-2,4,6-triamine.
| Compound Name | 5-[[3-(trifluoromethyl)phenyl]diazenyl]pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 121224764 |
| Molecular Formula | C11H10F3N7 |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 5-[[3-(trifluoromethyl)phenyl]diazenyl]pyrimidine-2,4,6-triamine |
| SMILES | Nc1nc(N)c(/N=N/c2cccc(C(F)(F)F)c2)c(N)n1 |
| InChI | InChI=1S/C11H10F3N7/c12-11(13,14)5-2-1-3-6(4-5)20-21-7-8(15)18-10(17)19-9(7)16/h1-4H,(H6,15,16,17,18,19)/b21-20+ |
| InChIKey | AAYHPCPQLDWCPF-QZQOTICOSA-N |
| XLogP | 2.66 |
| TPSA | 128.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|