C21H25F3N2 — CID 142659934
[4-(trifluoromethyl)phenyl]-[3-(2,4,4-trimethylpentan-2-yl)phenyl]diazene (PubChem CID 142659934) has the molecular formula C21H25F3N2 and a molecular weight of 362.44 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl]-[3-(2,4,4-trimethylpentan-2-yl)phenyl]diazene.
| Compound Name | [4-(trifluoromethyl)phenyl]-[3-(2,4,4-trimethylpentan-2-yl)phenyl]diazene |
|---|---|
| PubChem CID | 142659934 |
| Molecular Formula | C21H25F3N2 |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | [4-(trifluoromethyl)phenyl]-[3-(2,4,4-trimethylpentan-2-yl)phenyl]diazene |
| SMILES | CC(C)(C)CC(C)(C)c1cccc(/N=N/c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C21H25F3N2/c1-19(2,3)14-20(4,5)16-7-6-8-18(13-16)26-25-17-11-9-15(10-12-17)21(22,23)24/h6-13H,14H2,1-5H3/b26-25+ |
| InChIKey | XPKVBFIBJROFJC-OCEACIFDSA-N |
| XLogP | 7.83 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|