C10H19NO4 — CID 121226816
4-[(2S,6R)-1-amino-2,6-dihydroxycyclohexyl]butanoic acid (PubChem CID 121226816) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is 4-[(2S,6R)-1-amino-2,6-dihydroxycyclohexyl]butanoic acid.
| Compound Name | 4-[(2S,6R)-1-amino-2,6-dihydroxycyclohexyl]butanoic acid |
|---|---|
| PubChem CID | 121226816 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 4-[(2S,6R)-1-amino-2,6-dihydroxycyclohexyl]butanoic acid |
| SMILES | NC1(CCCC(=O)O)[C@H](O)CCC[C@@H]1O |
| InChI | InChI=1S/C10H19NO4/c11-10(6-2-5-9(14)15)7(12)3-1-4-8(10)13/h7-8,12-13H,1-6,11H2,(H,14,15)/t7-,8+,10? |
| InChIKey | JULPOYUVLAPGKI-JWHQNHQBSA-N |
| XLogP | -0.16 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |