C28H40CuN6O2S+ — CID 121231482
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[4-[bis(2-pyridin-2-ylethyl)amino]butyl]pentanamide;copper(1+) (PubChem CID 121231482) has the molecular formula C28H40CuN6O2S+ and a molecular weight of 588.28 g/mol. Its IUPAC name is 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[4-[bis(2-pyridin-2-ylethyl)amino]butyl]pentanamide;copper(1+).
| Compound Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[4-[bis(2-pyridin-2-ylethyl)amino]butyl]pentanamide;copper(1+) |
|---|---|
| PubChem CID | 121231482 |
| Molecular Formula | C28H40CuN6O2S+ |
| Molecular Weight | 588.28 g/mol |
| Exact Mass | 587.22 |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[4-[bis(2-pyridin-2-ylethyl)amino]butyl]pentanamide;copper(1+) |
| SMILES | O=C(CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21)NCCCCN(CCc1ccccn1)CCc1ccccn1.[Cu+] |
| InChI | InChI=1S/C28H40N6O2S.Cu/c35-26(12-2-1-11-25-27-24(21-37-25)32-28(36)33-27)31-17-7-8-18-34(19-13-22-9-3-5-15-29-22)20-14-23-10-4-6-16-30-23;/h3-6,9-10,15-16,24-25,27H,1-2,7-8,11-14,17-21H2,(H,31,35)(H2,32,33,36);/q;+1/t24-,25-,27-;/m0./s1 |
| InChIKey | GMDFXMPALXWONM-PBQYMGKRSA-N |
| XLogP | 3.18 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|