C19H30N6O4S — CID 121231514
tert-butyl N-[3-[4-[3-(5-ethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)propyl]triazol-1-yl]propyl]carbamate (PubChem CID 121231514) has the molecular formula C19H30N6O4S and a molecular weight of 438.55 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[3-(5-ethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)propyl]triazol-1-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[3-(5-ethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)propyl]triazol-1-yl]propyl]carbamate |
|---|---|
| PubChem CID | 121231514 |
| Molecular Formula | C19H30N6O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | tert-butyl N-[3-[4-[3-(5-ethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)propyl]triazol-1-yl]propyl]carbamate |
| SMILES | CCC1(CCCc2cn(CCCNC(=O)OC(C)(C)C)nn2)C(=O)NC(=S)NC1=O |
| InChI | InChI=1S/C19H30N6O4S/c1-5-19(14(26)21-16(30)22-15(19)27)9-6-8-13-12-25(24-23-13)11-7-10-20-17(28)29-18(2,3)4/h12H,5-11H2,1-4H3,(H,20,28)(H2,21,22,26,27,30) |
| InChIKey | SIKKRAOCLFEWFO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 127.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|