C19H26N8O3S — CID 121231511
N-[3-[4-[3-(5-ethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)propyl]triazol-1-yl]propyl]-2-(1H-imidazol-5-yl)acetamide (PubChem CID 121231511) has the molecular formula C19H26N8O3S and a molecular weight of 446.54 g/mol. Its IUPAC name is N-[3-[4-[3-(5-ethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)propyl]triazol-1-yl]propyl]-2-(1H-imidazol-5-yl)acetamide.
| Compound Name | N-[3-[4-[3-(5-ethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)propyl]triazol-1-yl]propyl]-2-(1H-imidazol-5-yl)acetamide |
|---|---|
| PubChem CID | 121231511 |
| Molecular Formula | C19H26N8O3S |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | N-[3-[4-[3-(5-ethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)propyl]triazol-1-yl]propyl]-2-(1H-imidazol-5-yl)acetamide |
| SMILES | CCC1(CCCc2cn(CCCNC(=O)Cc3cnc[nH]3)nn2)C(=O)NC(=S)NC1=O |
| InChI | InChI=1S/C19H26N8O3S/c1-2-19(16(29)23-18(31)24-17(19)30)6-3-5-13-11-27(26-25-13)8-4-7-21-15(28)9-14-10-20-12-22-14/h10-12H,2-9H2,1H3,(H,20,22)(H,21,28)(H2,23,24,29,30,31) |
| InChIKey | DNCZJQGNOZPICF-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 146.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|