C10H16N6O — CID 66268573
3-[4-[(1H-imidazol-5-ylmethylamino)methyl]triazol-1-yl]propan-1-ol (PubChem CID 66268573) has the molecular formula C10H16N6O and a molecular weight of 236.28 g/mol. Its IUPAC name is 3-[4-[(1H-imidazol-5-ylmethylamino)methyl]triazol-1-yl]propan-1-ol.
| Compound Name | 3-[4-[(1H-imidazol-5-ylmethylamino)methyl]triazol-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 66268573 |
| Molecular Formula | C10H16N6O |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 3-[4-[(1H-imidazol-5-ylmethylamino)methyl]triazol-1-yl]propan-1-ol |
| SMILES | OCCCn1cc(CNCc2cnc[nH]2)nn1 |
| InChI | InChI=1S/C10H16N6O/c17-3-1-2-16-7-10(14-15-16)6-11-4-9-5-12-8-13-9/h5,7-8,11,17H,1-4,6H2,(H,12,13) |
| InChIKey | MWPRXKUIFYYFCO-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |