C21H14Cl3F3N4OS — CID 121237640
1-(4-chlorobenzoyl)-3-(4-chlorophenyl)-1-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-methylamino]thiourea (PubChem CID 121237640) has the molecular formula C21H14Cl3F3N4OS and a molecular weight of 533.79 g/mol. Its IUPAC name is 1-(4-chlorobenzoyl)-3-(4-chlorophenyl)-1-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-methylamino]thiourea.
| Compound Name | 1-(4-chlorobenzoyl)-3-(4-chlorophenyl)-1-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-methylamino]thiourea |
|---|---|
| PubChem CID | 121237640 |
| Molecular Formula | C21H14Cl3F3N4OS |
| Molecular Weight | 533.79 g/mol |
| Exact Mass | 531.99 |
| IUPAC Name | 1-(4-chlorobenzoyl)-3-(4-chlorophenyl)-1-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-methylamino]thiourea |
| SMILES | CN(c1cc(C(F)(F)F)cc(Cl)n1)N(C(=O)c1ccc(Cl)cc1)C(=S)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H14Cl3F3N4OS/c1-30(18-11-13(21(25,26)27)10-17(24)29-18)31(19(32)12-2-4-14(22)5-3-12)20(33)28-16-8-6-15(23)7-9-16/h2-11H,1H3,(H,28,33) |
| InChIKey | PYUFVAHKJNAUGU-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.79 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|