C23H28ClN7O — CID 121253798
4-[8-(3-chloroanilino)-2-(cyclopentylamino)purin-9-yl]cyclohexane-1-carboxamide (PubChem CID 121253798) has the molecular formula C23H28ClN7O and a molecular weight of 453.98 g/mol. Its IUPAC name is 4-[8-(3-chloroanilino)-2-(cyclopentylamino)purin-9-yl]cyclohexane-1-carboxamide.
| Compound Name | 4-[8-(3-chloroanilino)-2-(cyclopentylamino)purin-9-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 121253798 |
| Molecular Formula | C23H28ClN7O |
| Molecular Weight | 453.98 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 4-[8-(3-chloroanilino)-2-(cyclopentylamino)purin-9-yl]cyclohexane-1-carboxamide |
| SMILES | NC(=O)C1CCC(n2c(Nc3cccc(Cl)c3)nc3cnc(NC4CCCC4)nc32)CC1 |
| InChI | InChI=1S/C23H28ClN7O/c24-15-4-3-7-17(12-15)28-23-29-19-13-26-22(27-16-5-1-2-6-16)30-21(19)31(23)18-10-8-14(9-11-18)20(25)32/h3-4,7,12-14,16,18H,1-2,5-6,8-11H2,(H2,25,32)(H,28,29)(H,26,27,30) |
| InChIKey | SWNIMSSHPKPRMJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.98 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |