C27H34N4O2 — CID 121255926
tert-butyl N-cyclohexyl-N-[(4-ethyl-6-pyridin-4-ylquinazolin-2-yl)methyl]carbamate (PubChem CID 121255926) has the molecular formula C27H34N4O2 and a molecular weight of 446.60 g/mol. Its IUPAC name is tert-butyl N-cyclohexyl-N-[(4-ethyl-6-pyridin-4-ylquinazolin-2-yl)methyl]carbamate.
| Compound Name | tert-butyl N-cyclohexyl-N-[(4-ethyl-6-pyridin-4-ylquinazolin-2-yl)methyl]carbamate |
|---|---|
| PubChem CID | 121255926 |
| Molecular Formula | C27H34N4O2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | tert-butyl N-cyclohexyl-N-[(4-ethyl-6-pyridin-4-ylquinazolin-2-yl)methyl]carbamate |
| SMILES | CCc1nc(CN(C(=O)OC(C)(C)C)C2CCCCC2)nc2ccc(-c3ccncc3)cc12 |
| InChI | InChI=1S/C27H34N4O2/c1-5-23-22-17-20(19-13-15-28-16-14-19)11-12-24(22)30-25(29-23)18-31(21-9-7-6-8-10-21)26(32)33-27(2,3)4/h11-17,21H,5-10,18H2,1-4H3 |
| InChIKey | XIWSCJNQRRFFME-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |