C21H18O — CID 121257819
(2R,13S)-14-methyl-12-oxapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),3,5,7,9,15,17,19-octaene (PubChem CID 121257819) has the molecular formula C21H18O and a molecular weight of 286.37 g/mol. Its IUPAC name is (2R,13S)-14-methyl-12-oxapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),3,5,7,9,15,17,19-octaene.
| Compound Name | (2R,13S)-14-methyl-12-oxapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),3,5,7,9,15,17,19-octaene |
|---|---|
| PubChem CID | 121257819 |
| Molecular Formula | C21H18O |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (2R,13S)-14-methyl-12-oxapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),3,5,7,9,15,17,19-octaene |
| SMILES | CC1c2ccccc2C=C2[C@H]3C=c4ccccc4=CC3O[C@H]21 |
| InChI | InChI=1S/C21H18O/c1-13-17-9-5-4-8-16(17)11-19-18-10-14-6-2-3-7-15(14)12-20(18)22-21(13)19/h2-13,18,20-21H,1H3/t13?,18-,20?,21+/m1/s1 |
| InChIKey | VOSNAVZDDIGOJJ-DBJHYWPPSA-N |
| XLogP | 2.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |