C11H11P — CID 132519844
1-methyl-1a,7a-dihydronaphtho[2,3-b]phosphirene (PubChem CID 132519844) has the molecular formula C11H11P and a molecular weight of 174.18 g/mol. Its IUPAC name is 1-methyl-1a,7a-dihydronaphtho[2,3-b]phosphirene.
| Compound Name | 1-methyl-1a,7a-dihydronaphtho[2,3-b]phosphirene |
|---|---|
| PubChem CID | 132519844 |
| Molecular Formula | C11H11P |
| Molecular Weight | 174.18 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | 1-methyl-1a,7a-dihydronaphtho[2,3-b]phosphirene |
| SMILES | CP1C2C=c3ccccc3=CC21 |
| InChI | InChI=1S/C11H11P/c1-12-10-6-8-4-2-3-5-9(8)7-11(10)12/h2-7,10-11H,1H3 |
| InChIKey | GJWSGAPHUNDZKB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.18 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|