About 2,3-di(propan-2-yl)-2,3-dihydronaphthalene
2,3-di(propan-2-yl)-2,3-dihydronaphthalene (PubChem CID 22950269) has the molecular formula C16H22
and a molecular weight of 214.35 g/mol. Its IUPAC name is 2,3-di(propan-2-yl)-2,3-dihydronaphthalene.
Molecular Properties
| Compound Name | 2,3-di(propan-2-yl)-2,3-dihydronaphthalene |
| PubChem CID | 22950269 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 2,3-di(propan-2-yl)-2,3-dihydronaphthalene |
| SMILES | CC(C)C1C=c2ccccc2=CC1C(C)C |
| InChI | InChI=1S/C16H22/c1-11(2)15-9-13-7-5-6-8-14(13)10-16(15)12(3)4/h5-12,15-16H,1-4H3 |
| InChIKey | YQIYQWZMUONTTO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,3-di(propan-2-yl)-2,3-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-di(propan-2-yl)-2,3-dihydronaphthalene?
The IUPAC name of 2,3-di(propan-2-yl)-2,3-dihydronaphthalene (CID 22950269) is 2,3-di(propan-2-yl)-2,3-dihydronaphthalene.
What is the SMILES notation for 2,3-di(propan-2-yl)-2,3-dihydronaphthalene?
The canonical SMILES for 2,3-di(propan-2-yl)-2,3-dihydronaphthalene is CC(C)C1C=c2ccccc2=CC1C(C)C.
What is the InChIKey of 2,3-di(propan-2-yl)-2,3-dihydronaphthalene?
The InChIKey is YQIYQWZMUONTTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22/c1-11(2)15-9-13-7-5-6-8-14(13)10-16(15)12(3)4/h5-12,15-16H,1-4H3.
What are the key properties of 2,3-di(propan-2-yl)-2,3-dihydronaphthalene?
2,3-di(propan-2-yl)-2,3-dihydronaphthalene has a molecular weight of 214.35 g/mol, XLogP of 2.81, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-di(propan-2-yl)-2,3-dihydronaphthalene is sourced from PubChem (CID 22950269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).