C12H14N2 — CID 142416235
2-propan-2-yl-2H-1,4-benzodiazepine (PubChem CID 142416235) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 2-propan-2-yl-2H-1,4-benzodiazepine.
| Compound Name | 2-propan-2-yl-2H-1,4-benzodiazepine |
|---|---|
| PubChem CID | 142416235 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 2-propan-2-yl-2H-1,4-benzodiazepine |
| SMILES | CC(C)C1C=NC=c2ccccc2=N1 |
| InChI | InChI=1S/C12H14N2/c1-9(2)12-8-13-7-10-5-3-4-6-11(10)14-12/h3-9,12H,1-2H3 |
| InChIKey | LCHJNXJUVRWQKT-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |