C28H20FeN4+2 — CID 50911488
iron(2+);2,10,18,26-tetrazapentacyclo[26.4.0.04,9.012,17.020,25]dotriaconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31-hexadecaene (PubChem CID 50911488) has the molecular formula C28H20FeN4+2 and a molecular weight of 468.34 g/mol. Its IUPAC name is iron(2+);2,10,18,26-tetrazapentacyclo[26.4.0.04,9.012,17.020,25]dotriaconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31-hexadecaene.
| Compound Name | iron(2+);2,10,18,26-tetrazapentacyclo[26.4.0.04,9.012,17.020,25]dotriaconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31-hexadecaene |
|---|---|
| PubChem CID | 50911488 |
| Molecular Formula | C28H20FeN4+2 |
| Molecular Weight | 468.34 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | iron(2+);2,10,18,26-tetrazapentacyclo[26.4.0.04,9.012,17.020,25]dotriaconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31-hexadecaene |
| SMILES | C1=c2cccc/c2=N/C=c2cccc/c2=N\C=c2cccc/c2=N\C=c2cccc/c2=N\1.[Fe+2] |
| InChI | InChI=1S/C28H20N4.Fe/c1-5-13-25-21(9-1)17-29-26-14-6-2-11-23(26)19-31-28-16-8-4-12-24(28)20-32-27-15-7-3-10-22(27)18-30-25;/h1-20H;/q;+2/b21-17?,22-18?,23-19?,24-20?,29-17?,29-26-,30-18?,30-25+,31-19?,31-28+,32-20?,32-27+; |
| InChIKey | HAPSLEZQHHAXRA-ATPSNFKJSA-N |
| XLogP | 0.23 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.34 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|